C17H20O6 — CID 14115361
ethyl 5-(3,4-dimethoxyphenyl)-2-ethoxyfuran-3-carboxylate (PubChem CID 14115361) has the molecular formula C17H20O6 and a molecular weight of 320.34 g/mol. Its IUPAC name is ethyl 5-(3,4-dimethoxyphenyl)-2-ethoxyfuran-3-carboxylate.
| Compound Name | ethyl 5-(3,4-dimethoxyphenyl)-2-ethoxyfuran-3-carboxylate |
|---|---|
| PubChem CID | 14115361 |
| Molecular Formula | C17H20O6 |
| Molecular Weight | 320.34 g/mol |
| Exact Mass | 320.13 |
| IUPAC Name | ethyl 5-(3,4-dimethoxyphenyl)-2-ethoxyfuran-3-carboxylate |
| SMILES | CCOC(=O)c1cc(-c2ccc(OC)c(OC)c2)oc1OCC |
| InChI | InChI=1S/C17H20O6/c1-5-21-16(18)12-10-14(23-17(12)22-6-2)11-7-8-13(19-3)15(9-11)20-4/h7-10H,5-6H2,1-4H3 |
| InChIKey | DUYGLGGYRJTJAX-UHFFFAOYSA-N |
| XLogP | 3.54 |
| TPSA | 67.13 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 23 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 320.34 |
| LogP ≤ 5 | 3.54 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 6 |