C20H20O5 — CID 143935869
5-[5-(3,4-dimethoxyphenyl)-3-methylfuran-2-yl]-2-methoxyphenol (PubChem CID 143935869) has the molecular formula C20H20O5 and a molecular weight of 340.38 g/mol. Its IUPAC name is 5-[5-(3,4-dimethoxyphenyl)-3-methylfuran-2-yl]-2-methoxyphenol.
| Compound Name | 5-[5-(3,4-dimethoxyphenyl)-3-methylfuran-2-yl]-2-methoxyphenol |
|---|---|
| PubChem CID | 143935869 |
| Molecular Formula | C20H20O5 |
| Molecular Weight | 340.38 g/mol |
| Exact Mass | 340.13 |
| IUPAC Name | 5-[5-(3,4-dimethoxyphenyl)-3-methylfuran-2-yl]-2-methoxyphenol |
| SMILES | COc1ccc(-c2oc(-c3ccc(OC)c(OC)c3)cc2C)cc1O |
| InChI | InChI=1S/C20H20O5/c1-12-9-18(13-5-8-17(23-3)19(11-13)24-4)25-20(12)14-6-7-16(22-2)15(21)10-14/h5-11,21H,1-4H3 |
| InChIKey | RJVYNAAFSKIPSC-UHFFFAOYSA-N |
| XLogP | 4.65 |
| TPSA | 61.06 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 25 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 340.38 |
| LogP ≤ 5 | 4.65 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |