C15H8Br2N4O4 — CID 3093249
N-[(5,7-dibromo-2-hydroxy-1H-indol-3-yl)imino]-3-nitrobenzamide (PubChem CID 3093249) has the molecular formula C15H8Br2N4O4 and a molecular weight of 468.06 g/mol. Its IUPAC name is N-[(5,7-dibromo-2-hydroxy-1H-indol-3-yl)imino]-3-nitrobenzamide.
| Compound Name | N-[(5,7-dibromo-2-hydroxy-1H-indol-3-yl)imino]-3-nitrobenzamide |
|---|---|
| PubChem CID | 3093249 |
| Molecular Formula | C15H8Br2N4O4 |
| Molecular Weight | 468.06 g/mol |
| Exact Mass | 465.89 |
| IUPAC Name | N-[(5,7-dibromo-2-hydroxy-1H-indol-3-yl)imino]-3-nitrobenzamide |
| SMILES | O=C(/N=N/c1c(O)[nH]c2c(Br)cc(Br)cc12)c1cccc([N+](=O)[O-])c1 |
| InChI | InChI=1S/C15H8Br2N4O4/c16-8-5-10-12(11(17)6-8)18-15(23)13(10)19-20-14(22)7-2-1-3-9(4-7)21(24)25/h1-6,18,23H/b20-19+ |
| InChIKey | IZCMXUYFCGOISZ-FMQUCBEESA-N |
| XLogP | 5.23 |
| TPSA | 120.95 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 25 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 468.06 |
| LogP ≤ 5 | 5.23 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'azo_A(324)', 'substructure': 'N/A'}, {'alert_name': 'diazo_group', 'substructure': 'N/A'}, {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|