C31H27BrN6O3 — CID 3943780
N-[3-[2-[[5-[(3-bromophenyl)diazenyl]-2-hydroxyphenyl]methylidene]hydrazinyl]-1-[4-(dimethylamino)phenyl]-3-oxoprop-1-en-2-yl]benzamide (PubChem CID 3943780) has the molecular formula C31H27BrN6O3 and a molecular weight of 611.50 g/mol. Its IUPAC name is N-[3-[2-[[5-[(3-bromophenyl)diazenyl]-2-hydroxyphenyl]methylidene]hydrazinyl]-1-[4-(dimethylamino)phenyl]-3-oxoprop-1-en-2-yl]benzamide.
| Compound Name | N-[3-[2-[[5-[(3-bromophenyl)diazenyl]-2-hydroxyphenyl]methylidene]hydrazinyl]-1-[4-(dimethylamino)phenyl]-3-oxoprop-1-en-2-yl]benzamide |
|---|---|
| PubChem CID | 3943780 |
| Molecular Formula | C31H27BrN6O3 |
| Molecular Weight | 611.50 g/mol |
| Exact Mass | 610.13 |
| IUPAC Name | N-[3-[2-[[5-[(3-bromophenyl)diazenyl]-2-hydroxyphenyl]methylidene]hydrazinyl]-1-[4-(dimethylamino)phenyl]-3-oxoprop-1-en-2-yl]benzamide |
| SMILES | CN(C)c1ccc(C=C(NC(=O)c2ccccc2)C(=O)NN=Cc2cc(/N=N/c3cccc(Br)c3)ccc2O)cc1 |
| InChI | InChI=1S/C31H27BrN6O3/c1-38(2)27-14-11-21(12-15-27)17-28(34-30(40)22-7-4-3-5-8-22)31(41)37-33-20-23-18-26(13-16-29(23)39)36-35-25-10-6-9-24(32)19-25/h3-20,39H,1-2H3,(H,34,40)(H,37,41)/b28-17?,33-20?,36-35+ |
| InChIKey | RIWIDXKYNMHBLQ-QROSNIPPSA-N |
| XLogP | 6.56 |
| TPSA | 118.75 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 41 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 611.50 |
| LogP ≤ 5 | 6.56 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'hzone_phenol_A(479)', 'substructure': 'N/A'}, {'alert_name': 'azo_A(324)', 'substructure': 'N/A'}, {'alert_name': 'anil_di_alk_B(251)', 'substructure': 'N/A'}, {'alert_name': 'diazo_group', 'substructure': 'N/A'}, {'alert_name': 'imine_1', 'substructure': 'N/A'} |
|---|