C28H26N2O4 — CID 163967167
3-[2-(4-hydroxyphenyl)ethyl]-1-[[4-[(E)-3-oxopent-1-enyl]phenyl]methyl]quinazoline-2,4-dione (PubChem CID 163967167) has the molecular formula C28H26N2O4 and a molecular weight of 454.53 g/mol. Its IUPAC name is 3-[2-(4-hydroxyphenyl)ethyl]-1-[[4-[(E)-3-oxopent-1-enyl]phenyl]methyl]quinazoline-2,4-dione.
| Compound Name | 3-[2-(4-hydroxyphenyl)ethyl]-1-[[4-[(E)-3-oxopent-1-enyl]phenyl]methyl]quinazoline-2,4-dione |
|---|---|
| PubChem CID | 163967167 |
| Molecular Formula | C28H26N2O4 |
| Molecular Weight | 454.53 g/mol |
| Exact Mass | 454.19 |
| IUPAC Name | 3-[2-(4-hydroxyphenyl)ethyl]-1-[[4-[(E)-3-oxopent-1-enyl]phenyl]methyl]quinazoline-2,4-dione |
| SMILES | CCC(=O)/C=C/c1ccc(Cn2c(=O)n(CCc3ccc(O)cc3)c(=O)c3ccccc32)cc1 |
| InChI | InChI=1S/C28H26N2O4/c1-2-23(31)14-11-20-7-9-22(10-8-20)19-30-26-6-4-3-5-25(26)27(33)29(28(30)34)18-17-21-12-15-24(32)16-13-21/h3-16,32H,2,17-19H2,1H3/b14-11+ |
| InChIKey | YGVSQABUEPWICE-SDNWHVSQSA-N |
| XLogP | 4.15 |
| TPSA | 81.30 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 34 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 454.53 |
| LogP ≤ 5 | 4.15 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'} |
|---|