C28H24F2N2O3 — CID 163995259
7-fluoro-3-[2-(4-fluorophenyl)ethyl]-1-[[4-[(E)-3-oxopent-1-enyl]phenyl]methyl]quinazoline-2,4-dione (PubChem CID 163995259) has the molecular formula C28H24F2N2O3 and a molecular weight of 474.51 g/mol. Its IUPAC name is 7-fluoro-3-[2-(4-fluorophenyl)ethyl]-1-[[4-[(E)-3-oxopent-1-enyl]phenyl]methyl]quinazoline-2,4-dione.
| Compound Name | 7-fluoro-3-[2-(4-fluorophenyl)ethyl]-1-[[4-[(E)-3-oxopent-1-enyl]phenyl]methyl]quinazoline-2,4-dione |
|---|---|
| PubChem CID | 163995259 |
| Molecular Formula | C28H24F2N2O3 |
| Molecular Weight | 474.51 g/mol |
| Exact Mass | 474.18 |
| IUPAC Name | 7-fluoro-3-[2-(4-fluorophenyl)ethyl]-1-[[4-[(E)-3-oxopent-1-enyl]phenyl]methyl]quinazoline-2,4-dione |
| SMILES | CCC(=O)/C=C/c1ccc(Cn2c(=O)n(CCc3ccc(F)cc3)c(=O)c3ccc(F)cc32)cc1 |
| InChI | InChI=1S/C28H24F2N2O3/c1-2-24(33)13-9-19-3-5-21(6-4-19)18-32-26-17-23(30)12-14-25(26)27(34)31(28(32)35)16-15-20-7-10-22(29)11-8-20/h3-14,17H,2,15-16,18H2,1H3/b13-9+ |
| InChIKey | VQTPGZNDUJYGSC-UKTHLTGXSA-N |
| XLogP | 4.72 |
| TPSA | 61.07 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 35 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 474.51 |
| LogP ≤ 5 | 4.72 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'} |
|---|