C17H14FN3O4 — CID 21027522
3-[2-(4-fluorophenyl)ethyl]-1-methyl-7-nitroquinazoline-2,4-dione (PubChem CID 21027522) has the molecular formula C17H14FN3O4 and a molecular weight of 343.31 g/mol. Its IUPAC name is 3-[2-(4-fluorophenyl)ethyl]-1-methyl-7-nitroquinazoline-2,4-dione.
| Compound Name | 3-[2-(4-fluorophenyl)ethyl]-1-methyl-7-nitroquinazoline-2,4-dione |
|---|---|
| PubChem CID | 21027522 |
| Molecular Formula | C17H14FN3O4 |
| Molecular Weight | 343.31 g/mol |
| Exact Mass | 343.10 |
| IUPAC Name | 3-[2-(4-fluorophenyl)ethyl]-1-methyl-7-nitroquinazoline-2,4-dione |
| SMILES | Cn1c(=O)n(CCc2ccc(F)cc2)c(=O)c2ccc([N+](=O)[O-])cc21 |
| InChI | InChI=1S/C17H14FN3O4/c1-19-15-10-13(21(24)25)6-7-14(15)16(22)20(17(19)23)9-8-11-2-4-12(18)5-3-11/h2-7,10H,8-9H2,1H3 |
| InChIKey | PKFZOYAPKJEOFB-UHFFFAOYSA-N |
| XLogP | 1.99 |
| TPSA | 87.14 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 25 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 343.31 |
| LogP ≤ 5 | 1.99 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|