C22H24FN5O3 — CID 22174998
3-[2-(4-fluorophenyl)ethyl]-2-[(4-methylpiperazin-1-yl)methyl]-7-nitroquinazolin-4-one (PubChem CID 22174998) has the molecular formula C22H24FN5O3 and a molecular weight of 425.46 g/mol. Its IUPAC name is 3-[2-(4-fluorophenyl)ethyl]-2-[(4-methylpiperazin-1-yl)methyl]-7-nitroquinazolin-4-one.
| Compound Name | 3-[2-(4-fluorophenyl)ethyl]-2-[(4-methylpiperazin-1-yl)methyl]-7-nitroquinazolin-4-one |
|---|---|
| PubChem CID | 22174998 |
| Molecular Formula | C22H24FN5O3 |
| Molecular Weight | 425.46 g/mol |
| Exact Mass | 425.19 |
| IUPAC Name | 3-[2-(4-fluorophenyl)ethyl]-2-[(4-methylpiperazin-1-yl)methyl]-7-nitroquinazolin-4-one |
| SMILES | CN1CCN(Cc2nc3cc([N+](=O)[O-])ccc3c(=O)n2CCc2ccc(F)cc2)CC1 |
| InChI | InChI=1S/C22H24FN5O3/c1-25-10-12-26(13-11-25)15-21-24-20-14-18(28(30)31)6-7-19(20)22(29)27(21)9-8-16-2-4-17(23)5-3-16/h2-7,14H,8-13,15H2,1H3 |
| InChIKey | DVKIRSISNIAUHR-UHFFFAOYSA-N |
| XLogP | 2.43 |
| TPSA | 84.51 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 31 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 425.46 |
| LogP ≤ 5 | 2.43 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|