C24H19FN4O3 — CID 46248309
2-(3,4-dihydro-1H-isoquinolin-2-ylmethyl)-3-(2-fluorophenyl)-6-nitroquinazolin-4-one (PubChem CID 46248309) has the molecular formula C24H19FN4O3 and a molecular weight of 430.44 g/mol. Its IUPAC name is 2-(3,4-dihydro-1H-isoquinolin-2-ylmethyl)-3-(2-fluorophenyl)-6-nitroquinazolin-4-one.
| Compound Name | 2-(3,4-dihydro-1H-isoquinolin-2-ylmethyl)-3-(2-fluorophenyl)-6-nitroquinazolin-4-one |
|---|---|
| PubChem CID | 46248309 |
| Molecular Formula | C24H19FN4O3 |
| Molecular Weight | 430.44 g/mol |
| Exact Mass | 430.14 |
| IUPAC Name | 2-(3,4-dihydro-1H-isoquinolin-2-ylmethyl)-3-(2-fluorophenyl)-6-nitroquinazolin-4-one |
| SMILES | O=c1c2cc([N+](=O)[O-])ccc2nc(CN2CCc3ccccc3C2)n1-c1ccccc1F |
| InChI | InChI=1S/C24H19FN4O3/c25-20-7-3-4-8-22(20)28-23(15-27-12-11-16-5-1-2-6-17(16)14-27)26-21-10-9-18(29(31)32)13-19(21)24(28)30/h1-10,13H,11-12,14-15H2 |
| InChIKey | DAYQGMQNPGJHNP-UHFFFAOYSA-N |
| XLogP | 3.99 |
| TPSA | 81.27 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 32 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 430.44 |
| LogP ≤ 5 | 3.99 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|