C24H20N4O3S — CID 4787791
1-(3,4-dihydro-1H-isoquinolin-2-yl)-2-(5-nitro-1-phenylbenzimidazol-2-yl)sulfanylethanone (PubChem CID 4787791) has the molecular formula C24H20N4O3S and a molecular weight of 444.52 g/mol. Its IUPAC name is 1-(3,4-dihydro-1H-isoquinolin-2-yl)-2-(5-nitro-1-phenylbenzimidazol-2-yl)sulfanylethanone.
| Compound Name | 1-(3,4-dihydro-1H-isoquinolin-2-yl)-2-(5-nitro-1-phenylbenzimidazol-2-yl)sulfanylethanone |
|---|---|
| PubChem CID | 4787791 |
| Molecular Formula | C24H20N4O3S |
| Molecular Weight | 444.52 g/mol |
| Exact Mass | 444.13 |
| IUPAC Name | 1-(3,4-dihydro-1H-isoquinolin-2-yl)-2-(5-nitro-1-phenylbenzimidazol-2-yl)sulfanylethanone |
| SMILES | O=C(CSc1nc2cc([N+](=O)[O-])ccc2n1-c1ccccc1)N1CCc2ccccc2C1 |
| InChI | InChI=1S/C24H20N4O3S/c29-23(26-13-12-17-6-4-5-7-18(17)15-26)16-32-24-25-21-14-20(28(30)31)10-11-22(21)27(24)19-8-2-1-3-9-19/h1-11,14H,12-13,15-16H2 |
| InChIKey | XFVZXQHGYFIIOP-UHFFFAOYSA-N |
| XLogP | 4.61 |
| TPSA | 81.27 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 32 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 444.52 |
| LogP ≤ 5 | 4.61 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|