C28H29N5O4 — CID 46248305
2-[[4-(2,5-dimethylphenyl)piperazin-1-yl]methyl]-3-(3-methoxyphenyl)-6-nitroquinazolin-4-one (PubChem CID 46248305) has the molecular formula C28H29N5O4 and a molecular weight of 499.57 g/mol. Its IUPAC name is 2-[[4-(2,5-dimethylphenyl)piperazin-1-yl]methyl]-3-(3-methoxyphenyl)-6-nitroquinazolin-4-one.
| Compound Name | 2-[[4-(2,5-dimethylphenyl)piperazin-1-yl]methyl]-3-(3-methoxyphenyl)-6-nitroquinazolin-4-one |
|---|---|
| PubChem CID | 46248305 |
| Molecular Formula | C28H29N5O4 |
| Molecular Weight | 499.57 g/mol |
| Exact Mass | 499.22 |
| IUPAC Name | 2-[[4-(2,5-dimethylphenyl)piperazin-1-yl]methyl]-3-(3-methoxyphenyl)-6-nitroquinazolin-4-one |
| SMILES | COc1cccc(-n2c(CN3CCN(c4cc(C)ccc4C)CC3)nc3ccc([N+](=O)[O-])cc3c2=O)c1 |
| InChI | InChI=1S/C28H29N5O4/c1-19-7-8-20(2)26(15-19)31-13-11-30(12-14-31)18-27-29-25-10-9-22(33(35)36)17-24(25)28(34)32(27)21-5-4-6-23(16-21)37-3/h4-10,15-17H,11-14,18H2,1-3H3 |
| InChIKey | XVFZPVQUJUDGKA-UHFFFAOYSA-N |
| XLogP | 4.24 |
| TPSA | 93.74 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 37 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 499.57 |
| LogP ≤ 5 | 4.24 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 8 |
| Structural Alerts | {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|