C26H23FN2O4 — CID 153408397
ethyl 4-[[7-fluoro-2,4-dioxo-3-(2-phenylethyl)quinazolin-1-yl]methyl]benzoate (PubChem CID 153408397) has the molecular formula C26H23FN2O4 and a molecular weight of 446.48 g/mol. Its IUPAC name is ethyl 4-[[7-fluoro-2,4-dioxo-3-(2-phenylethyl)quinazolin-1-yl]methyl]benzoate.
| Compound Name | ethyl 4-[[7-fluoro-2,4-dioxo-3-(2-phenylethyl)quinazolin-1-yl]methyl]benzoate |
|---|---|
| PubChem CID | 153408397 |
| Molecular Formula | C26H23FN2O4 |
| Molecular Weight | 446.48 g/mol |
| Exact Mass | 446.16 |
| IUPAC Name | ethyl 4-[[7-fluoro-2,4-dioxo-3-(2-phenylethyl)quinazolin-1-yl]methyl]benzoate |
| SMILES | CCOC(=O)c1ccc(Cn2c(=O)n(CCc3ccccc3)c(=O)c3ccc(F)cc32)cc1 |
| InChI | InChI=1S/C26H23FN2O4/c1-2-33-25(31)20-10-8-19(9-11-20)17-29-23-16-21(27)12-13-22(23)24(30)28(26(29)32)15-14-18-6-4-3-5-7-18/h3-13,16H,2,14-15,17H2,1H3 |
| InChIKey | LWNACHNSEHOVGO-UHFFFAOYSA-N |
| XLogP | 3.77 |
| TPSA | 70.30 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 33 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 446.48 |
| LogP ≤ 5 | 3.77 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 6 |