C27H22F3N3O5 — CID 153408405
[[4-[[2,4-dioxo-3-[2-[3-(trifluoromethyl)phenyl]ethyl]quinazolin-1-yl]methyl]benzoyl]amino] acetate (PubChem CID 153408405) has the molecular formula C27H22F3N3O5 and a molecular weight of 525.48 g/mol. Its IUPAC name is [[4-[[2,4-dioxo-3-[2-[3-(trifluoromethyl)phenyl]ethyl]quinazolin-1-yl]methyl]benzoyl]amino] acetate.
| Compound Name | [[4-[[2,4-dioxo-3-[2-[3-(trifluoromethyl)phenyl]ethyl]quinazolin-1-yl]methyl]benzoyl]amino] acetate |
|---|---|
| PubChem CID | 153408405 |
| Molecular Formula | C27H22F3N3O5 |
| Molecular Weight | 525.48 g/mol |
| Exact Mass | 525.15 |
| IUPAC Name | [[4-[[2,4-dioxo-3-[2-[3-(trifluoromethyl)phenyl]ethyl]quinazolin-1-yl]methyl]benzoyl]amino] acetate |
| SMILES | CC(=O)ONC(=O)c1ccc(Cn2c(=O)n(CCc3cccc(C(F)(F)F)c3)c(=O)c3ccccc32)cc1 |
| InChI | InChI=1S/C27H22F3N3O5/c1-17(34)38-31-24(35)20-11-9-19(10-12-20)16-33-23-8-3-2-7-22(23)25(36)32(26(33)37)14-13-18-5-4-6-21(15-18)27(28,29)30/h2-12,15H,13-14,16H2,1H3,(H,31,35) |
| InChIKey | MPUHPHGYGMUPIZ-UHFFFAOYSA-N |
| XLogP | 3.68 |
| TPSA | 99.40 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 38 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 525.48 |
| LogP ≤ 5 | 3.68 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|