C31H31F3N4O7 — CID 175692404
[[4-[[2,4-dioxo-3-(2-phenylethyl)quinazolin-1-yl]methyl]benzoyl]amino] 2-amino-3-methylbutanoate;2,2,2-trifluoroacetic acid (PubChem CID 175692404) has the molecular formula C31H31F3N4O7 and a molecular weight of 628.60 g/mol. Its IUPAC name is [[4-[[2,4-dioxo-3-(2-phenylethyl)quinazolin-1-yl]methyl]benzoyl]amino] 2-amino-3-methylbutanoate;2,2,2-trifluoroacetic acid.
| Compound Name | [[4-[[2,4-dioxo-3-(2-phenylethyl)quinazolin-1-yl]methyl]benzoyl]amino] 2-amino-3-methylbutanoate;2,2,2-trifluoroacetic acid |
|---|---|
| PubChem CID | 175692404 |
| Molecular Formula | C31H31F3N4O7 |
| Molecular Weight | 628.60 g/mol |
| Exact Mass | 628.21 |
| IUPAC Name | [[4-[[2,4-dioxo-3-(2-phenylethyl)quinazolin-1-yl]methyl]benzoyl]amino] 2-amino-3-methylbutanoate;2,2,2-trifluoroacetic acid |
| SMILES | CC(C)C(N)C(=O)ONC(=O)c1ccc(Cn2c(=O)n(CCc3ccccc3)c(=O)c3ccccc32)cc1.O=C(O)C(F)(F)F |
| InChI | InChI=1S/C29H30N4O5.C2HF3O2/c1-19(2)25(30)28(36)38-31-26(34)22-14-12-21(13-15-22)18-33-24-11-7-6-10-23(24)27(35)32(29(33)37)17-16-20-8-4-3-5-9-20;3-2(4,5)1(6)7/h3-15,19,25H,16-18,30H2,1-2H3,(H,31,34);(H,6,7) |
| InChIKey | KMFJMRUPFMUXNH-UHFFFAOYSA-N |
| XLogP | 3.26 |
| TPSA | 162.72 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 9 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 45 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 628.60 |
| LogP ≤ 5 | 3.26 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 9 |
| Structural Alerts | {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|