C31H26ClN3O4 — CID 153408409
4-[[7-chloro-2,4-dioxo-3-(2-phenylethyl)quinazolin-1-yl]methyl]-N-phenylmethoxybenzamide (PubChem CID 153408409) has the molecular formula C31H26ClN3O4 and a molecular weight of 540.02 g/mol. Its IUPAC name is 4-[[7-chloro-2,4-dioxo-3-(2-phenylethyl)quinazolin-1-yl]methyl]-N-phenylmethoxybenzamide.
| Compound Name | 4-[[7-chloro-2,4-dioxo-3-(2-phenylethyl)quinazolin-1-yl]methyl]-N-phenylmethoxybenzamide |
|---|---|
| PubChem CID | 153408409 |
| Molecular Formula | C31H26ClN3O4 |
| Molecular Weight | 540.02 g/mol |
| Exact Mass | 539.16 |
| IUPAC Name | 4-[[7-chloro-2,4-dioxo-3-(2-phenylethyl)quinazolin-1-yl]methyl]-N-phenylmethoxybenzamide |
| SMILES | O=C(NOCc1ccccc1)c1ccc(Cn2c(=O)n(CCc3ccccc3)c(=O)c3ccc(Cl)cc32)cc1 |
| InChI | InChI=1S/C31H26ClN3O4/c32-26-15-16-27-28(19-26)35(31(38)34(30(27)37)18-17-22-7-3-1-4-8-22)20-23-11-13-25(14-12-23)29(36)33-39-21-24-9-5-2-6-10-24/h1-16,19H,17-18,20-21H2,(H,33,36) |
| InChIKey | VGPLKPRABBGWCH-UHFFFAOYSA-N |
| XLogP | 4.97 |
| TPSA | 82.33 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 39 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 540.02 |
| LogP ≤ 5 | 4.97 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|