C25H22FN3O4 — CID 150400107
2-[4-[[2,4-dioxo-3-(2-phenylethyl)quinazolin-1-yl]methyl]-3-fluorophenyl]-N-hydroxyacetamide (PubChem CID 150400107) has the molecular formula C25H22FN3O4 and a molecular weight of 447.47 g/mol. Its IUPAC name is 2-[4-[[2,4-dioxo-3-(2-phenylethyl)quinazolin-1-yl]methyl]-3-fluorophenyl]-N-hydroxyacetamide.
| Compound Name | 2-[4-[[2,4-dioxo-3-(2-phenylethyl)quinazolin-1-yl]methyl]-3-fluorophenyl]-N-hydroxyacetamide |
|---|---|
| PubChem CID | 150400107 |
| Molecular Formula | C25H22FN3O4 |
| Molecular Weight | 447.47 g/mol |
| Exact Mass | 447.16 |
| IUPAC Name | 2-[4-[[2,4-dioxo-3-(2-phenylethyl)quinazolin-1-yl]methyl]-3-fluorophenyl]-N-hydroxyacetamide |
| SMILES | O=C(Cc1ccc(Cn2c(=O)n(CCc3ccccc3)c(=O)c3ccccc32)c(F)c1)NO |
| InChI | InChI=1S/C25H22FN3O4/c26-21-14-18(15-23(30)27-33)10-11-19(21)16-29-22-9-5-4-8-20(22)24(31)28(25(29)32)13-12-17-6-2-1-3-7-17/h1-11,14,33H,12-13,15-16H2,(H,27,30) |
| InChIKey | HDPCDKAVYCZYIY-UHFFFAOYSA-N |
| XLogP | 2.64 |
| TPSA | 93.33 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 33 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 447.47 |
| LogP ≤ 5 | 2.64 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'hydroxamic_acid', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|