C44H53ClN4O5 — CID 70231996
ethyl 4-[3-[4-(4-ethyl-N-methylanilino)-3-[3-[4-(2-methoxyphenyl)piperazin-1-yl]propoxy]benzoyl]indol-1-yl]butanoate;hydrochloride (PubChem CID 70231996) has the molecular formula C44H53ClN4O5 and a molecular weight of 753.38 g/mol. Its IUPAC name is ethyl 4-[3-[4-(4-ethyl-N-methylanilino)-3-[3-[4-(2-methoxyphenyl)piperazin-1-yl]propoxy]benzoyl]indol-1-yl]butanoate;hydrochloride.
| Compound Name | ethyl 4-[3-[4-(4-ethyl-N-methylanilino)-3-[3-[4-(2-methoxyphenyl)piperazin-1-yl]propoxy]benzoyl]indol-1-yl]butanoate;hydrochloride |
|---|---|
| PubChem CID | 70231996 |
| Molecular Formula | C44H53ClN4O5 |
| Molecular Weight | 753.38 g/mol |
| Exact Mass | 752.37 |
| IUPAC Name | ethyl 4-[3-[4-(4-ethyl-N-methylanilino)-3-[3-[4-(2-methoxyphenyl)piperazin-1-yl]propoxy]benzoyl]indol-1-yl]butanoate;hydrochloride |
| SMILES | CCOC(=O)CCCn1cc(C(=O)c2ccc(N(C)c3ccc(CC)cc3)c(OCCCN3CCN(c4ccccc4OC)CC3)c2)c2ccccc21.Cl |
| InChI | InChI=1S/C44H52N4O5.ClH/c1-5-33-18-21-35(22-19-33)45(3)39-23-20-34(44(50)37-32-48(25-11-17-43(49)52-6-2)38-14-8-7-13-36(37)38)31-42(39)53-30-12-24-46-26-28-47(29-27-46)40-15-9-10-16-41(40)51-4;/h7-10,13-16,18-23,31-32H,5-6,11-12,17,24-30H2,1-4H3;1H |
| InChIKey | KBDWEAYHOVUQEA-UHFFFAOYSA-N |
| XLogP | 8.57 |
| TPSA | 76.48 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 9 |
| Rotatable Bonds | 17 |
| Heavy Atoms | 54 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 753.38 |
| LogP ≤ 5 | 8.57 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 9 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|