C33H37ClN2O4 — CID 70231611
ethyl 4-[3-[3-(3-chloropropoxy)-4-(4-ethyl-N-methylanilino)benzoyl]indol-1-yl]butanoate (PubChem CID 70231611) has the molecular formula C33H37ClN2O4 and a molecular weight of 561.12 g/mol. Its IUPAC name is ethyl 4-[3-[3-(3-chloropropoxy)-4-(4-ethyl-N-methylanilino)benzoyl]indol-1-yl]butanoate.
| Compound Name | ethyl 4-[3-[3-(3-chloropropoxy)-4-(4-ethyl-N-methylanilino)benzoyl]indol-1-yl]butanoate |
|---|---|
| PubChem CID | 70231611 |
| Molecular Formula | C33H37ClN2O4 |
| Molecular Weight | 561.12 g/mol |
| Exact Mass | 560.24 |
| IUPAC Name | ethyl 4-[3-[3-(3-chloropropoxy)-4-(4-ethyl-N-methylanilino)benzoyl]indol-1-yl]butanoate |
| SMILES | CCOC(=O)CCCn1cc(C(=O)c2ccc(N(C)c3ccc(CC)cc3)c(OCCCCl)c2)c2ccccc21 |
| InChI | InChI=1S/C33H37ClN2O4/c1-4-24-13-16-26(17-14-24)35(3)30-18-15-25(22-31(30)40-21-9-19-34)33(38)28-23-36(20-8-12-32(37)39-5-2)29-11-7-6-10-27(28)29/h6-7,10-11,13-18,22-23H,4-5,8-9,12,19-21H2,1-3H3 |
| InChIKey | NFGVLGKFJSWRFK-UHFFFAOYSA-N |
| XLogP | 7.55 |
| TPSA | 60.77 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 14 |
| Heavy Atoms | 40 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 561.12 |
| LogP ≤ 5 | 7.55 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'alkyl_halide', 'substructure': 'N/A'} |
|---|