C30H32N2O4 — CID 56971557
7-[4-[4-(2-methoxyphenyl)piperazin-1-yl]butoxy]-4-phenylchromen-2-one (PubChem CID 56971557) has the molecular formula C30H32N2O4 and a molecular weight of 484.60 g/mol. Its IUPAC name is 7-[4-[4-(2-methoxyphenyl)piperazin-1-yl]butoxy]-4-phenylchromen-2-one.
| Compound Name | 7-[4-[4-(2-methoxyphenyl)piperazin-1-yl]butoxy]-4-phenylchromen-2-one |
|---|---|
| PubChem CID | 56971557 |
| Molecular Formula | C30H32N2O4 |
| Molecular Weight | 484.60 g/mol |
| Exact Mass | 484.24 |
| IUPAC Name | 7-[4-[4-(2-methoxyphenyl)piperazin-1-yl]butoxy]-4-phenylchromen-2-one |
| SMILES | COc1ccccc1N1CCN(CCCCOc2ccc3c(-c4ccccc4)cc(=O)oc3c2)CC1 |
| InChI | InChI=1S/C30H32N2O4/c1-34-28-12-6-5-11-27(28)32-18-16-31(17-19-32)15-7-8-20-35-24-13-14-25-26(23-9-3-2-4-10-23)22-30(33)36-29(25)21-24/h2-6,9-14,21-22H,7-8,15-20H2,1H3 |
| InChIKey | BLZQQQSUIRKTBO-UHFFFAOYSA-N |
| XLogP | 5.45 |
| TPSA | 55.15 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 36 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 484.60 |
| LogP ≤ 5 | 5.45 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'cumarine', 'substructure': 'N/A'} |
|---|