C37H40N4O3 — CID 118734708
4-phenyl-7-[2-[4-[3-(1,2,3,4-tetrahydroacridin-9-ylamino)propyl]piperazin-1-yl]ethoxy]chromen-2-one (PubChem CID 118734708) has the molecular formula C37H40N4O3 and a molecular weight of 588.75 g/mol. Its IUPAC name is 4-phenyl-7-[2-[4-[3-(1,2,3,4-tetrahydroacridin-9-ylamino)propyl]piperazin-1-yl]ethoxy]chromen-2-one.
| Compound Name | 4-phenyl-7-[2-[4-[3-(1,2,3,4-tetrahydroacridin-9-ylamino)propyl]piperazin-1-yl]ethoxy]chromen-2-one |
|---|---|
| PubChem CID | 118734708 |
| Molecular Formula | C37H40N4O3 |
| Molecular Weight | 588.75 g/mol |
| Exact Mass | 588.31 |
| IUPAC Name | 4-phenyl-7-[2-[4-[3-(1,2,3,4-tetrahydroacridin-9-ylamino)propyl]piperazin-1-yl]ethoxy]chromen-2-one |
| SMILES | O=c1cc(-c2ccccc2)c2ccc(OCCN3CCN(CCCNc4c5c(nc6ccccc46)CCCC5)CC3)cc2o1 |
| InChI | InChI=1S/C37H40N4O3/c42-36-26-32(27-9-2-1-3-10-27)29-16-15-28(25-35(29)44-36)43-24-23-41-21-19-40(20-22-41)18-8-17-38-37-30-11-4-6-13-33(30)39-34-14-7-5-12-31(34)37/h1-4,6,9-11,13,15-16,25-26H,5,7-8,12,14,17-24H2,(H,38,39) |
| InChIKey | JEVDJCMWVBWXEC-UHFFFAOYSA-N |
| XLogP | 6.39 |
| TPSA | 70.84 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 10 |
| Heavy Atoms | 44 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 588.75 |
| LogP ≤ 5 | 6.39 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'cumarine', 'substructure': 'N/A'} |
|---|