C30H34N4O3 — CID 118734725
7-[2-[4-[2-(1,2,3,4-tetrahydroacridin-9-ylamino)ethyl]piperazin-1-yl]ethoxy]chromen-2-one (PubChem CID 118734725) has the molecular formula C30H34N4O3 and a molecular weight of 498.63 g/mol. Its IUPAC name is 7-[2-[4-[2-(1,2,3,4-tetrahydroacridin-9-ylamino)ethyl]piperazin-1-yl]ethoxy]chromen-2-one.
| Compound Name | 7-[2-[4-[2-(1,2,3,4-tetrahydroacridin-9-ylamino)ethyl]piperazin-1-yl]ethoxy]chromen-2-one |
|---|---|
| PubChem CID | 118734725 |
| Molecular Formula | C30H34N4O3 |
| Molecular Weight | 498.63 g/mol |
| Exact Mass | 498.26 |
| IUPAC Name | 7-[2-[4-[2-(1,2,3,4-tetrahydroacridin-9-ylamino)ethyl]piperazin-1-yl]ethoxy]chromen-2-one |
| SMILES | O=c1ccc2ccc(OCCN3CCN(CCNc4c5c(nc6ccccc46)CCCC5)CC3)cc2o1 |
| InChI | InChI=1S/C30H34N4O3/c35-29-12-10-22-9-11-23(21-28(22)37-29)36-20-19-34-17-15-33(16-18-34)14-13-31-30-24-5-1-3-7-26(24)32-27-8-4-2-6-25(27)30/h1,3,5,7,9-12,21H,2,4,6,8,13-20H2,(H,31,32) |
| InChIKey | UAPFPZISLYDWMP-UHFFFAOYSA-N |
| XLogP | 4.33 |
| TPSA | 70.84 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 37 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 498.63 |
| LogP ≤ 5 | 4.33 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'cumarine', 'substructure': 'N/A'} |
|---|