C24H35FN2O2 — CID 69059428
7-fluoro-4-[(2R)-2-methyl-3-[(5S)-3-pentyl-8-azabicyclo[3.2.1]octan-8-yl]propyl]-1,4-benzoxazin-3-one (PubChem CID 69059428) has the molecular formula C24H35FN2O2 and a molecular weight of 402.55 g/mol. Its IUPAC name is 7-fluoro-4-[(2R)-2-methyl-3-[(5S)-3-pentyl-8-azabicyclo[3.2.1]octan-8-yl]propyl]-1,4-benzoxazin-3-one.
| Compound Name | 7-fluoro-4-[(2R)-2-methyl-3-[(5S)-3-pentyl-8-azabicyclo[3.2.1]octan-8-yl]propyl]-1,4-benzoxazin-3-one |
|---|---|
| PubChem CID | 69059428 |
| Molecular Formula | C24H35FN2O2 |
| Molecular Weight | 402.55 g/mol |
| Exact Mass | 402.27 |
| IUPAC Name | 7-fluoro-4-[(2R)-2-methyl-3-[(5S)-3-pentyl-8-azabicyclo[3.2.1]octan-8-yl]propyl]-1,4-benzoxazin-3-one |
| SMILES | CCCCCC1CC2CC[C@@H](C1)N2C[C@@H](C)CN1C(=O)COc2cc(F)ccc21 |
| InChI | InChI=1S/C24H35FN2O2/c1-3-4-5-6-18-11-20-8-9-21(12-18)26(20)14-17(2)15-27-22-10-7-19(25)13-23(22)29-16-24(27)28/h7,10,13,17-18,20-21H,3-6,8-9,11-12,14-16H2,1-2H3/t17-,18?,20+,21?/m1/s1 |
| InChIKey | CXHAFRUKXXHJKP-OMZYAQQMSA-N |
| XLogP | 5.01 |
| TPSA | 32.78 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 29 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 402.55 |
| LogP ≤ 5 | 5.01 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|