C24H34F2N2O2 — CID 68908117
6,7-difluoro-4-[2-methyl-3-[(1R,5S)-3-pentyl-8-azabicyclo[3.2.1]octan-8-yl]propyl]-1,4-benzoxazin-3-one (PubChem CID 68908117) has the molecular formula C24H34F2N2O2 and a molecular weight of 420.54 g/mol. Its IUPAC name is 6,7-difluoro-4-[2-methyl-3-[(1R,5S)-3-pentyl-8-azabicyclo[3.2.1]octan-8-yl]propyl]-1,4-benzoxazin-3-one.
| Compound Name | 6,7-difluoro-4-[2-methyl-3-[(1R,5S)-3-pentyl-8-azabicyclo[3.2.1]octan-8-yl]propyl]-1,4-benzoxazin-3-one |
|---|---|
| PubChem CID | 68908117 |
| Molecular Formula | C24H34F2N2O2 |
| Molecular Weight | 420.54 g/mol |
| Exact Mass | 420.26 |
| IUPAC Name | 6,7-difluoro-4-[2-methyl-3-[(1R,5S)-3-pentyl-8-azabicyclo[3.2.1]octan-8-yl]propyl]-1,4-benzoxazin-3-one |
| SMILES | CCCCCC1C[C@H]2CC[C@@H](C1)N2CC(C)CN1C(=O)COc2cc(F)c(F)cc21 |
| InChI | InChI=1S/C24H34F2N2O2/c1-3-4-5-6-17-9-18-7-8-19(10-17)27(18)13-16(2)14-28-22-11-20(25)21(26)12-23(22)30-15-24(28)29/h11-12,16-19H,3-10,13-15H2,1-2H3/t16?,17?,18-,19+ |
| InChIKey | BTFRCMRJRZEYLU-YHFFBGSDSA-N |
| XLogP | 5.15 |
| TPSA | 32.78 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 30 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 420.54 |
| LogP ≤ 5 | 5.15 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|