C14H15FN2O2S — CID 22073144
7-fluoro-6-isothiocyanato-4-(2-methylbutyl)-1,4-benzoxazin-3-one (PubChem CID 22073144) has the molecular formula C14H15FN2O2S and a molecular weight of 294.35 g/mol. Its IUPAC name is 7-fluoro-6-isothiocyanato-4-(2-methylbutyl)-1,4-benzoxazin-3-one.
| Compound Name | 7-fluoro-6-isothiocyanato-4-(2-methylbutyl)-1,4-benzoxazin-3-one |
|---|---|
| PubChem CID | 22073144 |
| Molecular Formula | C14H15FN2O2S |
| Molecular Weight | 294.35 g/mol |
| Exact Mass | 294.08 |
| IUPAC Name | 7-fluoro-6-isothiocyanato-4-(2-methylbutyl)-1,4-benzoxazin-3-one |
| SMILES | CCC(C)CN1C(=O)COc2cc(F)c(N=C=S)cc21 |
| InChI | InChI=1S/C14H15FN2O2S/c1-3-9(2)6-17-12-5-11(16-8-20)10(15)4-13(12)19-7-14(17)18/h4-5,9H,3,6-7H2,1-2H3 |
| InChIKey | HWBRRFGBKFXKBV-UHFFFAOYSA-N |
| XLogP | 3.33 |
| TPSA | 41.90 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 20 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 294.35 |
| LogP ≤ 5 | 3.33 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'Thiocarbonyl_group', 'substructure': 'N/A'} |
|---|