C14H25NO2 — CID 123312305
3-(3-pentylcyclohexyl)-1,3-oxazolidin-2-one (PubChem CID 123312305) has the molecular formula C14H25NO2 and a molecular weight of 239.36 g/mol. Its IUPAC name is 3-(3-pentylcyclohexyl)-1,3-oxazolidin-2-one.
| Compound Name | 3-(3-pentylcyclohexyl)-1,3-oxazolidin-2-one |
|---|---|
| PubChem CID | 123312305 |
| Molecular Formula | C14H25NO2 |
| Molecular Weight | 239.36 g/mol |
| Exact Mass | 239.19 |
| IUPAC Name | 3-(3-pentylcyclohexyl)-1,3-oxazolidin-2-one |
| SMILES | CCCCCC1CCCC(N2CCOC2=O)C1 |
| InChI | InChI=1S/C14H25NO2/c1-2-3-4-6-12-7-5-8-13(11-12)15-9-10-17-14(15)16/h12-13H,2-11H2,1H3 |
| InChIKey | SKOGEISLTILLDK-UHFFFAOYSA-N |
| XLogP | 3.58 |
| TPSA | 29.54 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 17 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 239.36 |
| LogP ≤ 5 | 3.58 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|