C10H15NO4 — CID 130702570
2-[3-(2-oxo-1,3-oxazolidin-3-yl)cyclopentyl]acetic acid (PubChem CID 130702570) has the molecular formula C10H15NO4 and a molecular weight of 213.23 g/mol. Its IUPAC name is 2-[3-(2-oxo-1,3-oxazolidin-3-yl)cyclopentyl]acetic acid.
| Compound Name | 2-[3-(2-oxo-1,3-oxazolidin-3-yl)cyclopentyl]acetic acid |
|---|---|
| PubChem CID | 130702570 |
| Molecular Formula | C10H15NO4 |
| Molecular Weight | 213.23 g/mol |
| Exact Mass | 213.10 |
| IUPAC Name | 2-[3-(2-oxo-1,3-oxazolidin-3-yl)cyclopentyl]acetic acid |
| SMILES | O=C(O)CC1CCC(N2CCOC2=O)C1 |
| InChI | InChI=1S/C10H15NO4/c12-9(13)6-7-1-2-8(5-7)11-3-4-15-10(11)14/h7-8H,1-6H2,(H,12,13) |
| InChIKey | WVUJPGUPBAFINI-UHFFFAOYSA-N |
| XLogP | 1.08 |
| TPSA | 66.84 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 15 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 213.23 |
| LogP ≤ 5 | 1.08 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |