2-[3-(2-oxo-1,3-oxazolidin-3-yl)cyclopentyl]acetic acid

C10H15NO4 — CID 130702570

IUPAC2-[3-(2-oxo-1,3-oxazolidin-3-yl)cyclopentyl]acetic acid
SMILESO=C(O)CC1CCC(N2CCOC2=O)C1
InChIInChI=1S/C10H15NO4/c12-9(13)6-7-1-2-8(5-7)11-3-4-15-10(11)14/h7-8H,1-6H2,(H,12,13)
InChIKeyWVUJPGUPBAFINI-UHFFFAOYSA-N
MW213.23 g/mol
LogP1.08
Rot. Bonds3

About 2-[3-(2-oxo-1,3-oxazolidin-3-yl)cyclopentyl]acetic acid

2-[3-(2-oxo-1,3-oxazolidin-3-yl)cyclopentyl]acetic acid (PubChem CID 130702570) has the molecular formula C10H15NO4 and a molecular weight of 213.23 g/mol. Its IUPAC name is 2-[3-(2-oxo-1,3-oxazolidin-3-yl)cyclopentyl]acetic acid.

Molecular Properties

Compound Name2-[3-(2-oxo-1,3-oxazolidin-3-yl)cyclopentyl]acetic acid
PubChem CID130702570
Molecular FormulaC10H15NO4
Molecular Weight213.23 g/mol
Exact Mass213.10
IUPAC Name2-[3-(2-oxo-1,3-oxazolidin-3-yl)cyclopentyl]acetic acid
SMILESO=C(O)CC1CCC(N2CCOC2=O)C1
InChIInChI=1S/C10H15NO4/c12-9(13)6-7-1-2-8(5-7)11-3-4-15-10(11)14/h7-8H,1-6H2,(H,12,13)
InChIKeyWVUJPGUPBAFINI-UHFFFAOYSA-N
XLogP1.08
TPSA66.84 Ų
H-Bond Donors1
H-Bond Acceptors3
Rotatable Bonds3
Heavy Atoms15
Complexity—

Lipinski Rule of Five

Passes Rule of Five

RuleValue
MW ≤ 500213.23
LogP ≤ 51.08
H-Bond Donors ≤ 51
H-Bond Acceptors ≤ 103

Analyze 2-[3-(2-oxo-1,3-oxazolidin-3-yl)cyclopentyl]acetic acid with MolForge

Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.

Launch Full Analysis

Frequently Asked Questions

What is the IUPAC name of 2-[3-(2-oxo-1,3-oxazolidin-3-yl)cyclopentyl]acetic acid?
The IUPAC name of 2-[3-(2-oxo-1,3-oxazolidin-3-yl)cyclopentyl]acetic acid (CID 130702570) is 2-[3-(2-oxo-1,3-oxazolidin-3-yl)cyclopentyl]acetic acid.
What is the SMILES notation for 2-[3-(2-oxo-1,3-oxazolidin-3-yl)cyclopentyl]acetic acid?
The canonical SMILES for 2-[3-(2-oxo-1,3-oxazolidin-3-yl)cyclopentyl]acetic acid is O=C(O)CC1CCC(N2CCOC2=O)C1.
What is the InChIKey of 2-[3-(2-oxo-1,3-oxazolidin-3-yl)cyclopentyl]acetic acid?
The InChIKey is WVUJPGUPBAFINI-UHFFFAOYSA-N. The full InChI is InChI=1S/C10H15NO4/c12-9(13)6-7-1-2-8(5-7)11-3-4-15-10(11)14/h7-8H,1-6H2,(H,12,13).
What are the key properties of 2-[3-(2-oxo-1,3-oxazolidin-3-yl)cyclopentyl]acetic acid?
2-[3-(2-oxo-1,3-oxazolidin-3-yl)cyclopentyl]acetic acid has a molecular weight of 213.23 g/mol, XLogP of 1.08, 3 rotatable bonds, 1 hydrogen bond donors, and 3 hydrogen bond acceptors.
Where does this data come from?
All data for 2-[3-(2-oxo-1,3-oxazolidin-3-yl)cyclopentyl]acetic acid is sourced from PubChem (CID 130702570), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).