About 1,3-diheptylcyclohexane
1,3-diheptylcyclohexane (PubChem CID 19973333) has the molecular formula C20H40
and a molecular weight of 280.54 g/mol. Its IUPAC name is 1,3-diheptylcyclohexane.
Molecular Properties
| Compound Name | 1,3-diheptylcyclohexane |
| PubChem CID | 19973333 |
| Molecular Formula | C20H40 |
| Molecular Weight | 280.54 g/mol |
| Exact Mass | 280.31 |
| IUPAC Name | 1,3-diheptylcyclohexane |
| SMILES | CCCCCCCC1CCCC(CCCCCCC)C1 |
| InChI | InChI=1S/C20H40/c1-3-5-7-9-11-14-19-16-13-17-20(18-19)15-12-10-8-6-4-2/h19-20H,3-18H2,1-2H3 |
| InChIKey | MELNPOIZEPXFHD-UHFFFAOYSA-N |
| XLogP | 7.51 |
| TPSA | 0.00 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | |
| Rotatable Bonds | 12 |
| Heavy Atoms | 20 |
| Complexity | — |
Lipinski Rule of Five
1 violation
| Rule | Value |
| MW ≤ 500 | 280.54 |
| LogP ≤ 5 | 7.51 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 0 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|
Analyze 1,3-diheptylcyclohexane with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 1,3-diheptylcyclohexane?
The IUPAC name of 1,3-diheptylcyclohexane (CID 19973333) is 1,3-diheptylcyclohexane.
What is the SMILES notation for 1,3-diheptylcyclohexane?
The canonical SMILES for 1,3-diheptylcyclohexane is CCCCCCCC1CCCC(CCCCCCC)C1.
What is the InChIKey of 1,3-diheptylcyclohexane?
The InChIKey is MELNPOIZEPXFHD-UHFFFAOYSA-N. The full InChI is InChI=1S/C20H40/c1-3-5-7-9-11-14-19-16-13-17-20(18-19)15-12-10-8-6-4-2/h19-20H,3-18H2,1-2H3.
What are the key properties of 1,3-diheptylcyclohexane?
1,3-diheptylcyclohexane has a molecular weight of 280.54 g/mol, XLogP of 7.51, 12 rotatable bonds, 0 hydrogen bond donors, and 0 hydrogen bond acceptors.
Where does this data come from?
All data for 1,3-diheptylcyclohexane is sourced from PubChem (CID 19973333), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).