C34H76 — CID 158750937
1,3-dipentylcyclohexane;methane;1-methyl-3-nonylcyclohexane;molecular hydrogen (PubChem CID 158750937) has the molecular formula C34H76 and a molecular weight of 484.98 g/mol. Its IUPAC name is 1,3-dipentylcyclohexane;methane;1-methyl-3-nonylcyclohexane;molecular hydrogen.
| Compound Name | 1,3-dipentylcyclohexane;methane;1-methyl-3-nonylcyclohexane;molecular hydrogen |
|---|---|
| PubChem CID | 158750937 |
| Molecular Formula | C34H76 |
| Molecular Weight | 484.98 g/mol |
| Exact Mass | 484.59 |
| IUPAC Name | 1,3-dipentylcyclohexane;methane;1-methyl-3-nonylcyclohexane;molecular hydrogen |
| SMILES | C.C.CCCCCC1CCCC(CCCCC)C1.CCCCCCCCCC1CCCC(C)C1.[H][H].[H][H] |
| InChI | InChI=1S/2C16H32.2CH4.2H2/c1-3-4-5-6-7-8-9-12-16-13-10-11-15(2)14-16;1-3-5-7-10-15-12-9-13-16(14-15)11-8-6-4-2;;;;/h2*15-16H,3-14H2,1-2H3;2*1H4;2*1H |
| InChIKey | INLXKGJNYNBNSK-UHFFFAOYSA-N |
| XLogP | 13.67 |
| TPSA | 0.00 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | |
| Rotatable Bonds | 16 |
| Heavy Atoms | 34 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 484.98 |
| LogP ≤ 5 | 13.67 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 0 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|