C18H14N2O3 — CID 18452161
3-[(6-formyl-3-oxo-1,4-benzoxazin-4-yl)methyl]-5-methylbenzonitrile (PubChem CID 18452161) has the molecular formula C18H14N2O3 and a molecular weight of 306.32 g/mol. Its IUPAC name is 3-[(6-formyl-3-oxo-1,4-benzoxazin-4-yl)methyl]-5-methylbenzonitrile.
| Compound Name | 3-[(6-formyl-3-oxo-1,4-benzoxazin-4-yl)methyl]-5-methylbenzonitrile |
|---|---|
| PubChem CID | 18452161 |
| Molecular Formula | C18H14N2O3 |
| Molecular Weight | 306.32 g/mol |
| Exact Mass | 306.10 |
| IUPAC Name | 3-[(6-formyl-3-oxo-1,4-benzoxazin-4-yl)methyl]-5-methylbenzonitrile |
| SMILES | Cc1cc(C#N)cc(CN2C(=O)COc3ccc(C=O)cc32)c1 |
| InChI | InChI=1S/C18H14N2O3/c1-12-4-14(8-19)6-15(5-12)9-20-16-7-13(10-21)2-3-17(16)23-11-18(20)22/h2-7,10H,9,11H2,1H3 |
| InChIKey | QCLJVZROVIALRR-UHFFFAOYSA-N |
| XLogP | 2.60 |
| TPSA | 70.40 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 23 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 306.32 |
| LogP ≤ 5 | 2.60 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'aldehyde', 'substructure': 'N/A'} |
|---|