C18H22N2O4 — CID 18452191
4-[2-(3,5-dimethylpiperidin-1-yl)-2-oxoethyl]-3-oxo-1,4-benzoxazine-6-carbaldehyde (PubChem CID 18452191) has the molecular formula C18H22N2O4 and a molecular weight of 330.38 g/mol. Its IUPAC name is 4-[2-(3,5-dimethylpiperidin-1-yl)-2-oxoethyl]-3-oxo-1,4-benzoxazine-6-carbaldehyde.
| Compound Name | 4-[2-(3,5-dimethylpiperidin-1-yl)-2-oxoethyl]-3-oxo-1,4-benzoxazine-6-carbaldehyde |
|---|---|
| PubChem CID | 18452191 |
| Molecular Formula | C18H22N2O4 |
| Molecular Weight | 330.38 g/mol |
| Exact Mass | 330.16 |
| IUPAC Name | 4-[2-(3,5-dimethylpiperidin-1-yl)-2-oxoethyl]-3-oxo-1,4-benzoxazine-6-carbaldehyde |
| SMILES | CC1CC(C)CN(C(=O)CN2C(=O)COc3ccc(C=O)cc32)C1 |
| InChI | InChI=1S/C18H22N2O4/c1-12-5-13(2)8-19(7-12)17(22)9-20-15-6-14(10-21)3-4-16(15)24-11-18(20)23/h3-4,6,10,12-13H,5,7-9,11H2,1-2H3 |
| InChIKey | HGFQQJDERXWFFJ-UHFFFAOYSA-N |
| XLogP | 1.73 |
| TPSA | 66.92 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 24 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 330.38 |
| LogP ≤ 5 | 1.73 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'aldehyde', 'substructure': 'N/A'} |
|---|