C17H14N2O2 — CID 114481318
3-methyl-4-[(3-oxo-1,4-benzoxazin-4-yl)methyl]benzonitrile (PubChem CID 114481318) has the molecular formula C17H14N2O2 and a molecular weight of 278.31 g/mol. Its IUPAC name is 3-methyl-4-[(3-oxo-1,4-benzoxazin-4-yl)methyl]benzonitrile.
| Compound Name | 3-methyl-4-[(3-oxo-1,4-benzoxazin-4-yl)methyl]benzonitrile |
|---|---|
| PubChem CID | 114481318 |
| Molecular Formula | C17H14N2O2 |
| Molecular Weight | 278.31 g/mol |
| Exact Mass | 278.11 |
| IUPAC Name | 3-methyl-4-[(3-oxo-1,4-benzoxazin-4-yl)methyl]benzonitrile |
| SMILES | Cc1cc(C#N)ccc1CN1C(=O)COc2ccccc21 |
| InChI | InChI=1S/C17H14N2O2/c1-12-8-13(9-18)6-7-14(12)10-19-15-4-2-3-5-16(15)21-11-17(19)20/h2-8H,10-11H2,1H3 |
| InChIKey | JXHCQNJJYVFGKW-UHFFFAOYSA-N |
| XLogP | 2.79 |
| TPSA | 53.33 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 21 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 278.31 |
| LogP ≤ 5 | 2.79 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |