C17H12ClN3O4 — CID 126645813
4-[(2-chloro-4-cyanophenyl)methyl]-N-hydroxy-3-oxo-1,4-benzoxazine-6-carboxamide (PubChem CID 126645813) has the molecular formula C17H12ClN3O4 and a molecular weight of 357.75 g/mol. Its IUPAC name is 4-[(2-chloro-4-cyanophenyl)methyl]-N-hydroxy-3-oxo-1,4-benzoxazine-6-carboxamide.
| Compound Name | 4-[(2-chloro-4-cyanophenyl)methyl]-N-hydroxy-3-oxo-1,4-benzoxazine-6-carboxamide |
|---|---|
| PubChem CID | 126645813 |
| Molecular Formula | C17H12ClN3O4 |
| Molecular Weight | 357.75 g/mol |
| Exact Mass | 357.05 |
| IUPAC Name | 4-[(2-chloro-4-cyanophenyl)methyl]-N-hydroxy-3-oxo-1,4-benzoxazine-6-carboxamide |
| SMILES | N#Cc1ccc(CN2C(=O)COc3ccc(C(=O)NO)cc32)c(Cl)c1 |
| InChI | InChI=1S/C17H12ClN3O4/c18-13-5-10(7-19)1-2-12(13)8-21-14-6-11(17(23)20-24)3-4-15(14)25-9-16(21)22/h1-6,24H,8-9H2,(H,20,23) |
| InChIKey | UHLWEOSIVCDSJX-UHFFFAOYSA-N |
| XLogP | 2.26 |
| TPSA | 102.66 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 25 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 357.75 |
| LogP ≤ 5 | 2.26 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'hydroxamic_acid', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|