C19H14N4O4 — CID 126645363
4-[(1-cyanoindolizin-2-yl)methyl]-N-hydroxy-3-oxo-1,4-benzoxazine-6-carboxamide (PubChem CID 126645363) has the molecular formula C19H14N4O4 and a molecular weight of 362.35 g/mol. Its IUPAC name is 4-[(1-cyanoindolizin-2-yl)methyl]-N-hydroxy-3-oxo-1,4-benzoxazine-6-carboxamide.
| Compound Name | 4-[(1-cyanoindolizin-2-yl)methyl]-N-hydroxy-3-oxo-1,4-benzoxazine-6-carboxamide |
|---|---|
| PubChem CID | 126645363 |
| Molecular Formula | C19H14N4O4 |
| Molecular Weight | 362.35 g/mol |
| Exact Mass | 362.10 |
| IUPAC Name | 4-[(1-cyanoindolizin-2-yl)methyl]-N-hydroxy-3-oxo-1,4-benzoxazine-6-carboxamide |
| SMILES | N#Cc1c(CN2C(=O)COc3ccc(C(=O)NO)cc32)cn2ccccc12 |
| InChI | InChI=1S/C19H14N4O4/c20-8-14-13(9-22-6-2-1-3-15(14)22)10-23-16-7-12(19(25)21-26)4-5-17(16)27-11-18(23)24/h1-7,9,26H,10-11H2,(H,21,25) |
| InChIKey | MWVIFACNMLAZFR-UHFFFAOYSA-N |
| XLogP | 1.86 |
| TPSA | 107.07 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 27 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 362.35 |
| LogP ≤ 5 | 1.86 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'hydroxamic_acid', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|