C19H14ClN3O4S — CID 126646121
4-[(5-chloro-2-phenyl-1,3-thiazol-4-yl)methyl]-N-hydroxy-3-oxo-1,4-benzoxazine-6-carboxamide (PubChem CID 126646121) has the molecular formula C19H14ClN3O4S and a molecular weight of 415.86 g/mol. Its IUPAC name is 4-[(5-chloro-2-phenyl-1,3-thiazol-4-yl)methyl]-N-hydroxy-3-oxo-1,4-benzoxazine-6-carboxamide.
| Compound Name | 4-[(5-chloro-2-phenyl-1,3-thiazol-4-yl)methyl]-N-hydroxy-3-oxo-1,4-benzoxazine-6-carboxamide |
|---|---|
| PubChem CID | 126646121 |
| Molecular Formula | C19H14ClN3O4S |
| Molecular Weight | 415.86 g/mol |
| Exact Mass | 415.04 |
| IUPAC Name | 4-[(5-chloro-2-phenyl-1,3-thiazol-4-yl)methyl]-N-hydroxy-3-oxo-1,4-benzoxazine-6-carboxamide |
| SMILES | O=C(NO)c1ccc2c(c1)N(Cc1nc(-c3ccccc3)sc1Cl)C(=O)CO2 |
| InChI | InChI=1S/C19H14ClN3O4S/c20-17-13(21-19(28-17)11-4-2-1-3-5-11)9-23-14-8-12(18(25)22-26)6-7-15(14)27-10-16(23)24/h1-8,26H,9-10H2,(H,22,25) |
| InChIKey | UKZYHTIECGMTDE-UHFFFAOYSA-N |
| XLogP | 3.51 |
| TPSA | 91.76 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 28 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 415.86 |
| LogP ≤ 5 | 3.51 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'hydroxamic_acid', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|