C17H15FN2O5 — CID 126646017
4-[(2-fluoro-4-methoxyphenyl)methyl]-N-hydroxy-3-oxo-1,4-benzoxazine-6-carboxamide (PubChem CID 126646017) has the molecular formula C17H15FN2O5 and a molecular weight of 346.31 g/mol. Its IUPAC name is 4-[(2-fluoro-4-methoxyphenyl)methyl]-N-hydroxy-3-oxo-1,4-benzoxazine-6-carboxamide.
| Compound Name | 4-[(2-fluoro-4-methoxyphenyl)methyl]-N-hydroxy-3-oxo-1,4-benzoxazine-6-carboxamide |
|---|---|
| PubChem CID | 126646017 |
| Molecular Formula | C17H15FN2O5 |
| Molecular Weight | 346.31 g/mol |
| Exact Mass | 346.10 |
| IUPAC Name | 4-[(2-fluoro-4-methoxyphenyl)methyl]-N-hydroxy-3-oxo-1,4-benzoxazine-6-carboxamide |
| SMILES | COc1ccc(CN2C(=O)COc3ccc(C(=O)NO)cc32)c(F)c1 |
| InChI | InChI=1S/C17H15FN2O5/c1-24-12-4-2-11(13(18)7-12)8-20-14-6-10(17(22)19-23)3-5-15(14)25-9-16(20)21/h2-7,23H,8-9H2,1H3,(H,19,22) |
| InChIKey | LSLYLMHKQYHMKL-UHFFFAOYSA-N |
| XLogP | 1.88 |
| TPSA | 88.10 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 25 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 346.31 |
| LogP ≤ 5 | 1.88 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'hydroxamic_acid', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|