C18H14N4O4 — CID 9237521
3-cyano-N'-[2-(3-oxo-1,4-benzoxazin-4-yl)acetyl]benzohydrazide (PubChem CID 9237521) has the molecular formula C18H14N4O4 and a molecular weight of 350.33 g/mol. Its IUPAC name is 3-cyano-N'-[2-(3-oxo-1,4-benzoxazin-4-yl)acetyl]benzohydrazide.
| Compound Name | 3-cyano-N'-[2-(3-oxo-1,4-benzoxazin-4-yl)acetyl]benzohydrazide |
|---|---|
| PubChem CID | 9237521 |
| Molecular Formula | C18H14N4O4 |
| Molecular Weight | 350.33 g/mol |
| Exact Mass | 350.10 |
| IUPAC Name | 3-cyano-N'-[2-(3-oxo-1,4-benzoxazin-4-yl)acetyl]benzohydrazide |
| SMILES | N#Cc1cccc(C(=O)NNC(=O)CN2C(=O)COc3ccccc32)c1 |
| InChI | InChI=1S/C18H14N4O4/c19-9-12-4-3-5-13(8-12)18(25)21-20-16(23)10-22-14-6-1-2-7-15(14)26-11-17(22)24/h1-8H,10-11H2,(H,20,23)(H,21,25) |
| InChIKey | XYAQCSAZAAIZLV-UHFFFAOYSA-N |
| XLogP | 0.74 |
| TPSA | 111.53 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 26 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 350.33 |
| LogP ≤ 5 | 0.74 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|