C16H13BrN4O4 — CID 39039312
N'-[2-(7-bromo-3-oxo-1,4-benzoxazin-4-yl)acetyl]pyridine-3-carbohydrazide (PubChem CID 39039312) has the molecular formula C16H13BrN4O4 and a molecular weight of 405.21 g/mol. Its IUPAC name is N'-[2-(7-bromo-3-oxo-1,4-benzoxazin-4-yl)acetyl]pyridine-3-carbohydrazide.
| Compound Name | N'-[2-(7-bromo-3-oxo-1,4-benzoxazin-4-yl)acetyl]pyridine-3-carbohydrazide |
|---|---|
| PubChem CID | 39039312 |
| Molecular Formula | C16H13BrN4O4 |
| Molecular Weight | 405.21 g/mol |
| Exact Mass | 404.01 |
| IUPAC Name | N'-[2-(7-bromo-3-oxo-1,4-benzoxazin-4-yl)acetyl]pyridine-3-carbohydrazide |
| SMILES | O=C(CN1C(=O)COc2cc(Br)ccc21)NNC(=O)c1cccnc1 |
| InChI | InChI=1S/C16H13BrN4O4/c17-11-3-4-12-13(6-11)25-9-15(23)21(12)8-14(22)19-20-16(24)10-2-1-5-18-7-10/h1-7H,8-9H2,(H,19,22)(H,20,24) |
| InChIKey | JXQVIWBNLGZBKU-UHFFFAOYSA-N |
| XLogP | 1.03 |
| TPSA | 100.63 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 25 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 405.21 |
| LogP ≤ 5 | 1.03 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|