C20H23BrN2O3 — CID 78872494
N-(2-adamantyl)-2-(7-bromo-3-oxo-1,4-benzoxazin-4-yl)acetamide (PubChem CID 78872494) has the molecular formula C20H23BrN2O3 and a molecular weight of 419.32 g/mol. Its IUPAC name is N-(2-adamantyl)-2-(7-bromo-3-oxo-1,4-benzoxazin-4-yl)acetamide.
| Compound Name | N-(2-adamantyl)-2-(7-bromo-3-oxo-1,4-benzoxazin-4-yl)acetamide |
|---|---|
| PubChem CID | 78872494 |
| Molecular Formula | C20H23BrN2O3 |
| Molecular Weight | 419.32 g/mol |
| Exact Mass | 418.09 |
| IUPAC Name | N-(2-adamantyl)-2-(7-bromo-3-oxo-1,4-benzoxazin-4-yl)acetamide |
| SMILES | O=C(CN1C(=O)COc2cc(Br)ccc21)NC1C2CC3CC(C2)CC1C3 |
| InChI | InChI=1S/C20H23BrN2O3/c21-15-1-2-16-17(8-15)26-10-19(25)23(16)9-18(24)22-20-13-4-11-3-12(6-13)7-14(20)5-11/h1-2,8,11-14,20H,3-7,9-10H2,(H,22,24) |
| InChIKey | DOBMEVHEBOBZTJ-UHFFFAOYSA-N |
| XLogP | 3.12 |
| TPSA | 58.64 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 26 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 419.32 |
| LogP ≤ 5 | 3.12 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |