C13H16BrN3O3 — CID 119502516
2-(7-bromo-3-oxo-1,4-benzoxazin-4-yl)-N-[2-(methylamino)ethyl]acetamide (PubChem CID 119502516) has the molecular formula C13H16BrN3O3 and a molecular weight of 342.19 g/mol. Its IUPAC name is 2-(7-bromo-3-oxo-1,4-benzoxazin-4-yl)-N-[2-(methylamino)ethyl]acetamide.
| Compound Name | 2-(7-bromo-3-oxo-1,4-benzoxazin-4-yl)-N-[2-(methylamino)ethyl]acetamide |
|---|---|
| PubChem CID | 119502516 |
| Molecular Formula | C13H16BrN3O3 |
| Molecular Weight | 342.19 g/mol |
| Exact Mass | 341.04 |
| IUPAC Name | 2-(7-bromo-3-oxo-1,4-benzoxazin-4-yl)-N-[2-(methylamino)ethyl]acetamide |
| SMILES | CNCCNC(=O)CN1C(=O)COc2cc(Br)ccc21 |
| InChI | InChI=1S/C13H16BrN3O3/c1-15-4-5-16-12(18)7-17-10-3-2-9(14)6-11(10)20-8-13(17)19/h2-3,6,15H,4-5,7-8H2,1H3,(H,16,18) |
| InChIKey | KOCOQNRKQHKCEN-UHFFFAOYSA-N |
| XLogP | 0.51 |
| TPSA | 70.67 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 20 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 342.19 |
| LogP ≤ 5 | 0.51 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|