C16H19BrN2O5 — CID 119220106
6-[[2-(7-bromo-3-oxo-1,4-benzoxazin-4-yl)acetyl]amino]hexanoic acid (PubChem CID 119220106) has the molecular formula C16H19BrN2O5 and a molecular weight of 399.24 g/mol. Its IUPAC name is 6-[[2-(7-bromo-3-oxo-1,4-benzoxazin-4-yl)acetyl]amino]hexanoic acid.
| Compound Name | 6-[[2-(7-bromo-3-oxo-1,4-benzoxazin-4-yl)acetyl]amino]hexanoic acid |
|---|---|
| PubChem CID | 119220106 |
| Molecular Formula | C16H19BrN2O5 |
| Molecular Weight | 399.24 g/mol |
| Exact Mass | 398.05 |
| IUPAC Name | 6-[[2-(7-bromo-3-oxo-1,4-benzoxazin-4-yl)acetyl]amino]hexanoic acid |
| SMILES | O=C(O)CCCCCNC(=O)CN1C(=O)COc2cc(Br)ccc21 |
| InChI | InChI=1S/C16H19BrN2O5/c17-11-5-6-12-13(8-11)24-10-15(21)19(12)9-14(20)18-7-3-1-2-4-16(22)23/h5-6,8H,1-4,7,9-10H2,(H,18,20)(H,22,23) |
| InChIKey | UCXJVIYILGPLBM-UHFFFAOYSA-N |
| XLogP | 1.94 |
| TPSA | 95.94 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 24 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 399.24 |
| LogP ≤ 5 | 1.94 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|