C24H21BrN2O4 — CID 60592083
2-(7-bromo-3-oxo-1,4-benzoxazin-4-yl)-N-[2-(2-phenylphenoxy)ethyl]acetamide (PubChem CID 60592083) has the molecular formula C24H21BrN2O4 and a molecular weight of 481.35 g/mol. Its IUPAC name is 2-(7-bromo-3-oxo-1,4-benzoxazin-4-yl)-N-[2-(2-phenylphenoxy)ethyl]acetamide.
| Compound Name | 2-(7-bromo-3-oxo-1,4-benzoxazin-4-yl)-N-[2-(2-phenylphenoxy)ethyl]acetamide |
|---|---|
| PubChem CID | 60592083 |
| Molecular Formula | C24H21BrN2O4 |
| Molecular Weight | 481.35 g/mol |
| Exact Mass | 480.07 |
| IUPAC Name | 2-(7-bromo-3-oxo-1,4-benzoxazin-4-yl)-N-[2-(2-phenylphenoxy)ethyl]acetamide |
| SMILES | O=C(CN1C(=O)COc2cc(Br)ccc21)NCCOc1ccccc1-c1ccccc1 |
| InChI | InChI=1S/C24H21BrN2O4/c25-18-10-11-20-22(14-18)31-16-24(29)27(20)15-23(28)26-12-13-30-21-9-5-4-8-19(21)17-6-2-1-3-7-17/h1-11,14H,12-13,15-16H2,(H,26,28) |
| InChIKey | JPKXQKPWZFSJIM-UHFFFAOYSA-N |
| XLogP | 4.04 |
| TPSA | 67.87 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 31 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 481.35 |
| LogP ≤ 5 | 4.04 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|