C17H19BrN2O7 — CID 39403095
diethyl 2-[[2-(7-bromo-3-oxo-1,4-benzoxazin-4-yl)acetyl]amino]propanedioate (PubChem CID 39403095) has the molecular formula C17H19BrN2O7 and a molecular weight of 443.25 g/mol. Its IUPAC name is diethyl 2-[[2-(7-bromo-3-oxo-1,4-benzoxazin-4-yl)acetyl]amino]propanedioate.
| Compound Name | diethyl 2-[[2-(7-bromo-3-oxo-1,4-benzoxazin-4-yl)acetyl]amino]propanedioate |
|---|---|
| PubChem CID | 39403095 |
| Molecular Formula | C17H19BrN2O7 |
| Molecular Weight | 443.25 g/mol |
| Exact Mass | 442.04 |
| IUPAC Name | diethyl 2-[[2-(7-bromo-3-oxo-1,4-benzoxazin-4-yl)acetyl]amino]propanedioate |
| SMILES | CCOC(=O)C(NC(=O)CN1C(=O)COc2cc(Br)ccc21)C(=O)OCC |
| InChI | InChI=1S/C17H19BrN2O7/c1-3-25-16(23)15(17(24)26-4-2)19-13(21)8-20-11-6-5-10(18)7-12(11)27-9-14(20)22/h5-7,15H,3-4,8-9H2,1-2H3,(H,19,21) |
| InChIKey | VQPXRHWUGXWQAD-UHFFFAOYSA-N |
| XLogP | 0.79 |
| TPSA | 111.24 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 27 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 443.25 |
| LogP ≤ 5 | 0.79 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'beta-keto/anhydride', 'substructure': 'N/A'} |
|---|