C19H18BrNO4 — CID 38959105
(2,4,6-trimethylphenyl) 2-(7-bromo-3-oxo-1,4-benzoxazin-4-yl)acetate (PubChem CID 38959105) has the molecular formula C19H18BrNO4 and a molecular weight of 404.26 g/mol. Its IUPAC name is (2,4,6-trimethylphenyl) 2-(7-bromo-3-oxo-1,4-benzoxazin-4-yl)acetate.
| Compound Name | (2,4,6-trimethylphenyl) 2-(7-bromo-3-oxo-1,4-benzoxazin-4-yl)acetate |
|---|---|
| PubChem CID | 38959105 |
| Molecular Formula | C19H18BrNO4 |
| Molecular Weight | 404.26 g/mol |
| Exact Mass | 403.04 |
| IUPAC Name | (2,4,6-trimethylphenyl) 2-(7-bromo-3-oxo-1,4-benzoxazin-4-yl)acetate |
| SMILES | Cc1cc(C)c(OC(=O)CN2C(=O)COc3cc(Br)ccc32)c(C)c1 |
| InChI | InChI=1S/C19H18BrNO4/c1-11-6-12(2)19(13(3)7-11)25-18(23)9-21-15-5-4-14(20)8-16(15)24-10-17(21)22/h4-8H,9-10H2,1-3H3 |
| InChIKey | VJQVZDCIKYDCSW-UHFFFAOYSA-N |
| XLogP | 3.71 |
| TPSA | 55.84 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 25 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 404.26 |
| LogP ≤ 5 | 3.71 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'phenol_ester', 'substructure': 'N/A'} |
|---|