C16H21NO4 — CID 51045402
ethyl 2-(7-tert-butyl-3-oxo-1,4-benzoxazin-4-yl)acetate (PubChem CID 51045402) has the molecular formula C16H21NO4 and a molecular weight of 291.35 g/mol. Its IUPAC name is ethyl 2-(7-tert-butyl-3-oxo-1,4-benzoxazin-4-yl)acetate.
| Compound Name | ethyl 2-(7-tert-butyl-3-oxo-1,4-benzoxazin-4-yl)acetate |
|---|---|
| PubChem CID | 51045402 |
| Molecular Formula | C16H21NO4 |
| Molecular Weight | 291.35 g/mol |
| Exact Mass | 291.15 |
| IUPAC Name | ethyl 2-(7-tert-butyl-3-oxo-1,4-benzoxazin-4-yl)acetate |
| SMILES | CCOC(=O)CN1C(=O)COc2cc(C(C)(C)C)ccc21 |
| InChI | InChI=1S/C16H21NO4/c1-5-20-15(19)9-17-12-7-6-11(16(2,3)4)8-13(12)21-10-14(17)18/h6-8H,5,9-10H2,1-4H3 |
| InChIKey | AWVYOIWQYRGITQ-UHFFFAOYSA-N |
| XLogP | 2.27 |
| TPSA | 55.84 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 21 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 291.35 |
| LogP ≤ 5 | 2.27 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |