C18H15N3O3 — CID 110783550
3-cyano-N-[(4-methyl-3-oxo-1,4-benzoxazin-6-yl)methyl]benzamide (PubChem CID 110783550) has the molecular formula C18H15N3O3 and a molecular weight of 321.34 g/mol. Its IUPAC name is 3-cyano-N-[(4-methyl-3-oxo-1,4-benzoxazin-6-yl)methyl]benzamide.
| Compound Name | 3-cyano-N-[(4-methyl-3-oxo-1,4-benzoxazin-6-yl)methyl]benzamide |
|---|---|
| PubChem CID | 110783550 |
| Molecular Formula | C18H15N3O3 |
| Molecular Weight | 321.34 g/mol |
| Exact Mass | 321.11 |
| IUPAC Name | 3-cyano-N-[(4-methyl-3-oxo-1,4-benzoxazin-6-yl)methyl]benzamide |
| SMILES | CN1C(=O)COc2ccc(CNC(=O)c3cccc(C#N)c3)cc21 |
| InChI | InChI=1S/C18H15N3O3/c1-21-15-8-13(5-6-16(15)24-11-17(21)22)10-20-18(23)14-4-2-3-12(7-14)9-19/h2-8H,10-11H2,1H3,(H,20,23) |
| InChIKey | FNAAUSVSULYKDR-UHFFFAOYSA-N |
| XLogP | 1.84 |
| TPSA | 82.43 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 24 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 321.34 |
| LogP ≤ 5 | 1.84 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |