C17H16N2O4 — CID 110783576
phenyl N-[(4-methyl-3-oxo-1,4-benzoxazin-6-yl)methyl]carbamate (PubChem CID 110783576) has the molecular formula C17H16N2O4 and a molecular weight of 312.32 g/mol. Its IUPAC name is phenyl N-[(4-methyl-3-oxo-1,4-benzoxazin-6-yl)methyl]carbamate.
| Compound Name | phenyl N-[(4-methyl-3-oxo-1,4-benzoxazin-6-yl)methyl]carbamate |
|---|---|
| PubChem CID | 110783576 |
| Molecular Formula | C17H16N2O4 |
| Molecular Weight | 312.32 g/mol |
| Exact Mass | 312.11 |
| IUPAC Name | phenyl N-[(4-methyl-3-oxo-1,4-benzoxazin-6-yl)methyl]carbamate |
| SMILES | CN1C(=O)COc2ccc(CNC(=O)Oc3ccccc3)cc21 |
| InChI | InChI=1S/C17H16N2O4/c1-19-14-9-12(7-8-15(14)22-11-16(19)20)10-18-17(21)23-13-5-3-2-4-6-13/h2-9H,10-11H2,1H3,(H,18,21) |
| InChIKey | WOXZXWVYAFRKEJ-UHFFFAOYSA-N |
| XLogP | 2.33 |
| TPSA | 67.87 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 23 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 312.32 |
| LogP ≤ 5 | 2.33 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |