C17H17NO4 — CID 110780538
phenyl N-(3,4-dihydro-2H-1,5-benzodioxepin-7-ylmethyl)carbamate (PubChem CID 110780538) has the molecular formula C17H17NO4 and a molecular weight of 299.33 g/mol. Its IUPAC name is phenyl N-(3,4-dihydro-2H-1,5-benzodioxepin-7-ylmethyl)carbamate.
| Compound Name | phenyl N-(3,4-dihydro-2H-1,5-benzodioxepin-7-ylmethyl)carbamate |
|---|---|
| PubChem CID | 110780538 |
| Molecular Formula | C17H17NO4 |
| Molecular Weight | 299.33 g/mol |
| Exact Mass | 299.12 |
| IUPAC Name | phenyl N-(3,4-dihydro-2H-1,5-benzodioxepin-7-ylmethyl)carbamate |
| SMILES | O=C(NCc1ccc2c(c1)OCCCO2)Oc1ccccc1 |
| InChI | InChI=1S/C17H17NO4/c19-17(22-14-5-2-1-3-6-14)18-12-13-7-8-15-16(11-13)21-10-4-9-20-15/h1-3,5-8,11H,4,9-10,12H2,(H,18,19) |
| InChIKey | CJBLPTFJRZZKIR-UHFFFAOYSA-N |
| XLogP | 3.14 |
| TPSA | 56.79 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 22 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 299.33 |
| LogP ≤ 5 | 3.14 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |