C17H16N2 — CID 114480954
4-(2,3-dihydroindol-1-ylmethyl)-3-methylbenzonitrile (PubChem CID 114480954) has the molecular formula C17H16N2 and a molecular weight of 248.33 g/mol. Its IUPAC name is 4-(2,3-dihydroindol-1-ylmethyl)-3-methylbenzonitrile.
| Compound Name | 4-(2,3-dihydroindol-1-ylmethyl)-3-methylbenzonitrile |
|---|---|
| PubChem CID | 114480954 |
| Molecular Formula | C17H16N2 |
| Molecular Weight | 248.33 g/mol |
| Exact Mass | 248.13 |
| IUPAC Name | 4-(2,3-dihydroindol-1-ylmethyl)-3-methylbenzonitrile |
| SMILES | Cc1cc(C#N)ccc1CN1CCc2ccccc21 |
| InChI | InChI=1S/C17H16N2/c1-13-10-14(11-18)6-7-16(13)12-19-9-8-15-4-2-3-5-17(15)19/h2-7,10H,8-9,12H2,1H3 |
| InChIKey | OPHDBAXZEXGJQN-UHFFFAOYSA-N |
| XLogP | 3.43 |
| TPSA | 27.03 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 19 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 248.33 |
| LogP ≤ 5 | 3.43 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |