C14H14N2O2 — CID 114481351
4-[(2,6-dioxopiperidin-1-yl)methyl]-3-methylbenzonitrile (PubChem CID 114481351) has the molecular formula C14H14N2O2 and a molecular weight of 242.28 g/mol. Its IUPAC name is 4-[(2,6-dioxopiperidin-1-yl)methyl]-3-methylbenzonitrile.
| Compound Name | 4-[(2,6-dioxopiperidin-1-yl)methyl]-3-methylbenzonitrile |
|---|---|
| PubChem CID | 114481351 |
| Molecular Formula | C14H14N2O2 |
| Molecular Weight | 242.28 g/mol |
| Exact Mass | 242.11 |
| IUPAC Name | 4-[(2,6-dioxopiperidin-1-yl)methyl]-3-methylbenzonitrile |
| SMILES | Cc1cc(C#N)ccc1CN1C(=O)CCCC1=O |
| InChI | InChI=1S/C14H14N2O2/c1-10-7-11(8-15)5-6-12(10)9-16-13(17)3-2-4-14(16)18/h5-7H,2-4,9H2,1H3 |
| InChIKey | MXUHNYMSLLAQFI-UHFFFAOYSA-N |
| XLogP | 1.91 |
| TPSA | 61.17 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 18 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 242.28 |
| LogP ≤ 5 | 1.91 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'phthalimide', 'substructure': 'N/A'} |
|---|