C15H17N3O2 — CID 114481242
4-[(2,2-dimethyl-3,5-dioxopiperazin-1-yl)methyl]-3-methylbenzonitrile (PubChem CID 114481242) has the molecular formula C15H17N3O2 and a molecular weight of 271.32 g/mol. Its IUPAC name is 4-[(2,2-dimethyl-3,5-dioxopiperazin-1-yl)methyl]-3-methylbenzonitrile.
| Compound Name | 4-[(2,2-dimethyl-3,5-dioxopiperazin-1-yl)methyl]-3-methylbenzonitrile |
|---|---|
| PubChem CID | 114481242 |
| Molecular Formula | C15H17N3O2 |
| Molecular Weight | 271.32 g/mol |
| Exact Mass | 271.13 |
| IUPAC Name | 4-[(2,2-dimethyl-3,5-dioxopiperazin-1-yl)methyl]-3-methylbenzonitrile |
| SMILES | Cc1cc(C#N)ccc1CN1CC(=O)NC(=O)C1(C)C |
| InChI | InChI=1S/C15H17N3O2/c1-10-6-11(7-16)4-5-12(10)8-18-9-13(19)17-14(20)15(18,2)3/h4-6H,8-9H2,1-3H3,(H,17,19,20) |
| InChIKey | XFOKBEGTBKQBHN-UHFFFAOYSA-N |
| XLogP | 1.10 |
| TPSA | 73.20 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 20 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 271.32 |
| LogP ≤ 5 | 1.10 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'phthalimide', 'substructure': 'N/A'} |
|---|